C28H24N2O5 — CID 92957246
7-[2-[(3S)-3-(4-methoxyphenyl)-5-phenyl-3,4-dihydropyrazol-2-yl]-2-oxoethoxy]-4-methylchromen-2-one (PubChem CID 92957246) has the molecular formula C28H24N2O5 and a molecular weight of 468.51 g/mol. Its IUPAC name is 7-[2-[(3S)-3-(4-methoxyphenyl)-5-phenyl-3,4-dihydropyrazol-2-yl]-2-oxoethoxy]-4-methylchromen-2-one.
| Compound Name | 7-[2-[(3S)-3-(4-methoxyphenyl)-5-phenyl-3,4-dihydropyrazol-2-yl]-2-oxoethoxy]-4-methylchromen-2-one |
|---|---|
| PubChem CID | 92957246 |
| Molecular Formula | C28H24N2O5 |
| Molecular Weight | 468.51 g/mol |
| Exact Mass | 468.17 |
| IUPAC Name | 7-[2-[(3S)-3-(4-methoxyphenyl)-5-phenyl-3,4-dihydropyrazol-2-yl]-2-oxoethoxy]-4-methylchromen-2-one |
| SMILES | COc1ccc([C@@H]2CC(c3ccccc3)=NN2C(=O)COc2ccc3c(C)cc(=O)oc3c2)cc1 |
| InChI | InChI=1S/C28H24N2O5/c1-18-14-28(32)35-26-15-22(12-13-23(18)26)34-17-27(31)30-25(20-8-10-21(33-2)11-9-20)16-24(29-30)19-6-4-3-5-7-19/h3-15,25H,16-17H2,1-2H3/t25-/m0/s1 |
| InChIKey | TVTVQTSJQKWFHQ-VWLOTQADSA-N |
| XLogP | 4.87 |
| TPSA | 81.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.51 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|