C17H26N4S — CID 929580
N',N'-diethyl-N-[(6R)-6-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl]ethane-1,2-diamine (PubChem CID 929580) has the molecular formula C17H26N4S and a molecular weight of 318.49 g/mol. Its IUPAC name is N',N'-diethyl-N-[(6R)-6-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl]ethane-1,2-diamine.
| Compound Name | N',N'-diethyl-N-[(6R)-6-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 929580 |
| Molecular Formula | C17H26N4S |
| Molecular Weight | 318.49 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | N',N'-diethyl-N-[(6R)-6-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl]ethane-1,2-diamine |
| SMILES | CCN(CC)CCNc1ncnc2sc3c(c12)C[C@H](C)CC3 |
| InChI | InChI=1S/C17H26N4S/c1-4-21(5-2)9-8-18-16-15-13-10-12(3)6-7-14(13)22-17(15)20-11-19-16/h11-12H,4-10H2,1-3H3,(H,18,19,20)/t12-/m1/s1 |
| InChIKey | IMWLHHPIVNYXAE-GFCCVEGCSA-N |
| XLogP | 3.57 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.49 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |