C17H17ClN2OS — CID 9295801
2-[(5-chlorothiophen-2-yl)methyl-methylamino]-1-(2-methyl-1H-indol-3-yl)ethanone (PubChem CID 9295801) has the molecular formula C17H17ClN2OS and a molecular weight of 332.86 g/mol. Its IUPAC name is 2-[(5-chlorothiophen-2-yl)methyl-methylamino]-1-(2-methyl-1H-indol-3-yl)ethanone.
| Compound Name | 2-[(5-chlorothiophen-2-yl)methyl-methylamino]-1-(2-methyl-1H-indol-3-yl)ethanone |
|---|---|
| PubChem CID | 9295801 |
| Molecular Formula | C17H17ClN2OS |
| Molecular Weight | 332.86 g/mol |
| Exact Mass | 332.08 |
| IUPAC Name | 2-[(5-chlorothiophen-2-yl)methyl-methylamino]-1-(2-methyl-1H-indol-3-yl)ethanone |
| SMILES | Cc1[nH]c2ccccc2c1C(=O)CN(C)Cc1ccc(Cl)s1 |
| InChI | InChI=1S/C17H17ClN2OS/c1-11-17(13-5-3-4-6-14(13)19-11)15(21)10-20(2)9-12-7-8-16(18)22-12/h3-8,19H,9-10H2,1-2H3 |
| InChIKey | IVCWFJHCGPCQTO-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.86 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |