C28H36N4O4 — CID 92958154
ethyl (6S)-3-butyl-6-[3-(butylcarbamoylamino)phenyl]-2-oxo-4-phenyl-1,6-dihydropyrimidine-5-carboxylate (PubChem CID 92958154) has the molecular formula C28H36N4O4 and a molecular weight of 492.62 g/mol. Its IUPAC name is ethyl (6S)-3-butyl-6-[3-(butylcarbamoylamino)phenyl]-2-oxo-4-phenyl-1,6-dihydropyrimidine-5-carboxylate.
| Compound Name | ethyl (6S)-3-butyl-6-[3-(butylcarbamoylamino)phenyl]-2-oxo-4-phenyl-1,6-dihydropyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 92958154 |
| Molecular Formula | C28H36N4O4 |
| Molecular Weight | 492.62 g/mol |
| Exact Mass | 492.27 |
| IUPAC Name | ethyl (6S)-3-butyl-6-[3-(butylcarbamoylamino)phenyl]-2-oxo-4-phenyl-1,6-dihydropyrimidine-5-carboxylate |
| SMILES | CCCCNC(=O)Nc1cccc([C@@H]2NC(=O)N(CCCC)C(c3ccccc3)=C2C(=O)OCC)c1 |
| InChI | InChI=1S/C28H36N4O4/c1-4-7-17-29-27(34)30-22-16-12-15-21(19-22)24-23(26(33)36-6-3)25(20-13-10-9-11-14-20)32(18-8-5-2)28(35)31-24/h9-16,19,24H,4-8,17-18H2,1-3H3,(H,31,35)(H2,29,30,34)/t24-/m0/s1 |
| InChIKey | XASIGAXWMKKESO-DEOSSOPVSA-N |
| XLogP | 5.45 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.62 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|