About 1-(1,3-benzothiazol-2-yl)-3-(2,4-difluorophenyl)urea
1-(1,3-benzothiazol-2-yl)-3-(2,4-difluorophenyl)urea (PubChem CID 929625) has the molecular formula C14H9F2N3OS
and a molecular weight of 305.31 g/mol. Its IUPAC name is 1-(1,3-benzothiazol-2-yl)-3-(2,4-difluorophenyl)urea.
Molecular Properties
| Compound Name | 1-(1,3-benzothiazol-2-yl)-3-(2,4-difluorophenyl)urea |
| PubChem CID | 929625 |
| Molecular Formula | C14H9F2N3OS |
| Molecular Weight | 305.31 g/mol |
| Exact Mass | 305.04 |
| IUPAC Name | 1-(1,3-benzothiazol-2-yl)-3-(2,4-difluorophenyl)urea |
| SMILES | O=C(Nc1nc2ccccc2s1)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C14H9F2N3OS/c15-8-5-6-10(9(16)7-8)17-13(20)19-14-18-11-3-1-2-4-12(11)21-14/h1-7H,(H2,17,18,19,20) |
| InChIKey | GFBFLPIKCGPYJK-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.31 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(1,3-benzothiazol-2-yl)-3-(2,4-difluorophenyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,3-benzothiazol-2-yl)-3-(2,4-difluorophenyl)urea?
The IUPAC name of 1-(1,3-benzothiazol-2-yl)-3-(2,4-difluorophenyl)urea (CID 929625) is 1-(1,3-benzothiazol-2-yl)-3-(2,4-difluorophenyl)urea.
What is the SMILES notation for 1-(1,3-benzothiazol-2-yl)-3-(2,4-difluorophenyl)urea?
The canonical SMILES for 1-(1,3-benzothiazol-2-yl)-3-(2,4-difluorophenyl)urea is O=C(Nc1nc2ccccc2s1)Nc1ccc(F)cc1F.
What is the InChIKey of 1-(1,3-benzothiazol-2-yl)-3-(2,4-difluorophenyl)urea?
The InChIKey is GFBFLPIKCGPYJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9F2N3OS/c15-8-5-6-10(9(16)7-8)17-13(20)19-14-18-11-3-1-2-4-12(11)21-14/h1-7H,(H2,17,18,19,20).
What are the key properties of 1-(1,3-benzothiazol-2-yl)-3-(2,4-difluorophenyl)urea?
1-(1,3-benzothiazol-2-yl)-3-(2,4-difluorophenyl)urea has a molecular weight of 305.31 g/mol, XLogP of 4.22, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,3-benzothiazol-2-yl)-3-(2,4-difluorophenyl)urea is sourced from PubChem (CID 929625), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).