C22H33N4O3+ — CID 9296593
methyl-[[(5R,6R)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]methyl]-[(4-morpholin-4-ylphenyl)methyl]azanium (PubChem CID 9296593) has the molecular formula C22H33N4O3+ and a molecular weight of 401.53 g/mol. Its IUPAC name is methyl-[[(5R,6R)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]methyl]-[(4-morpholin-4-ylphenyl)methyl]azanium.
| Compound Name | methyl-[[(5R,6R)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]methyl]-[(4-morpholin-4-ylphenyl)methyl]azanium |
|---|---|
| PubChem CID | 9296593 |
| Molecular Formula | C22H33N4O3+ |
| Molecular Weight | 401.53 g/mol |
| Exact Mass | 401.25 |
| IUPAC Name | methyl-[[(5R,6R)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]methyl]-[(4-morpholin-4-ylphenyl)methyl]azanium |
| SMILES | C[C@@H]1CCCC[C@@]12NC(=O)N(C[NH+](C)Cc1ccc(N3CCOCC3)cc1)C2=O |
| InChI | InChI=1S/C22H32N4O3/c1-17-5-3-4-10-22(17)20(27)26(21(28)23-22)16-24(2)15-18-6-8-19(9-7-18)25-11-13-29-14-12-25/h6-9,17H,3-5,10-16H2,1-2H3,(H,23,28)/p+1/t17-,22-/m1/s1 |
| InChIKey | OUCDQSOYKRLJNP-VGOFRKELSA-O |
| XLogP | 1.00 |
| TPSA | 66.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.53 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|