About 4-[(E,1S)-1-hydroxy-4-methylsulfanylbut-3-enyl]benzonitrile
4-[(E,1S)-1-hydroxy-4-methylsulfanylbut-3-enyl]benzonitrile (PubChem CID 92966603) has the molecular formula C12H13NOS
and a molecular weight of 219.31 g/mol. Its IUPAC name is 4-[(E,1S)-1-hydroxy-4-methylsulfanylbut-3-enyl]benzonitrile.
Molecular Properties
| Compound Name | 4-[(E,1S)-1-hydroxy-4-methylsulfanylbut-3-enyl]benzonitrile |
| PubChem CID | 92966603 |
| Molecular Formula | C12H13NOS |
| Molecular Weight | 219.31 g/mol |
| Exact Mass | 219.07 |
| IUPAC Name | 4-[(E,1S)-1-hydroxy-4-methylsulfanylbut-3-enyl]benzonitrile |
| SMILES | CS/C=C/C[C@H](O)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C12H13NOS/c1-15-8-2-3-12(14)11-6-4-10(9-13)5-7-11/h2,4-8,12,14H,3H2,1H3/b8-2+/t12-/m0/s1 |
| InChIKey | FHRSKJZVDRKHLR-NKWNXKNASA-N |
| XLogP | 2.86 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.31 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[(E,1S)-1-hydroxy-4-methylsulfanylbut-3-enyl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(E,1S)-1-hydroxy-4-methylsulfanylbut-3-enyl]benzonitrile?
The IUPAC name of 4-[(E,1S)-1-hydroxy-4-methylsulfanylbut-3-enyl]benzonitrile (CID 92966603) is 4-[(E,1S)-1-hydroxy-4-methylsulfanylbut-3-enyl]benzonitrile.
What is the SMILES notation for 4-[(E,1S)-1-hydroxy-4-methylsulfanylbut-3-enyl]benzonitrile?
The canonical SMILES for 4-[(E,1S)-1-hydroxy-4-methylsulfanylbut-3-enyl]benzonitrile is CS/C=C/C[C@H](O)c1ccc(C#N)cc1.
What is the InChIKey of 4-[(E,1S)-1-hydroxy-4-methylsulfanylbut-3-enyl]benzonitrile?
The InChIKey is FHRSKJZVDRKHLR-NKWNXKNASA-N. The full InChI is InChI=1S/C12H13NOS/c1-15-8-2-3-12(14)11-6-4-10(9-13)5-7-11/h2,4-8,12,14H,3H2,1H3/b8-2+/t12-/m0/s1.
What are the key properties of 4-[(E,1S)-1-hydroxy-4-methylsulfanylbut-3-enyl]benzonitrile?
4-[(E,1S)-1-hydroxy-4-methylsulfanylbut-3-enyl]benzonitrile has a molecular weight of 219.31 g/mol, XLogP of 2.86, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(E,1S)-1-hydroxy-4-methylsulfanylbut-3-enyl]benzonitrile is sourced from PubChem (CID 92966603), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).