C22H30N4O — CID 92967293
(1S,2S,5R,6S,9S,10S,13S)-1,5-dimethyl-16,18,20,21-tetrazahexacyclo[11.11.0.02,10.05,9.015,23.017,21]tetracosa-15,17,19,22-tetraen-6-ol (PubChem CID 92967293) has the molecular formula C22H30N4O and a molecular weight of 366.51 g/mol. Its IUPAC name is (1S,2S,5R,6S,9S,10S,13S)-1,5-dimethyl-16,18,20,21-tetrazahexacyclo[11.11.0.02,10.05,9.015,23.017,21]tetracosa-15,17,19,22-tetraen-6-ol.
| Compound Name | (1S,2S,5R,6S,9S,10S,13S)-1,5-dimethyl-16,18,20,21-tetrazahexacyclo[11.11.0.02,10.05,9.015,23.017,21]tetracosa-15,17,19,22-tetraen-6-ol |
|---|---|
| PubChem CID | 92967293 |
| Molecular Formula | C22H30N4O |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.24 |
| IUPAC Name | (1S,2S,5R,6S,9S,10S,13S)-1,5-dimethyl-16,18,20,21-tetrazahexacyclo[11.11.0.02,10.05,9.015,23.017,21]tetracosa-15,17,19,22-tetraen-6-ol |
| SMILES | C[C@]12Cc3cn4ncnc4nc3C[C@@H]1CC[C@H]1[C@@H]2CC[C@@]2(C)[C@@H](O)CC[C@@H]12 |
| InChI | InChI=1S/C22H30N4O/c1-21-8-7-17-15(16(21)5-6-19(21)27)4-3-14-9-18-13(10-22(14,17)2)11-26-20(25-18)23-12-24-26/h11-12,14-17,19,27H,3-10H2,1-2H3/t14-,15+,16-,17-,19-,21+,22-/m0/s1 |
| InChIKey | UEZMTEGBVOHXSV-RUCBHUPZSA-N |
| XLogP | 3.44 |
| TPSA | 63.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |