C13H12N2O4 — CID 92968054
6-[(3S)-5,5-dimethyl-2-oxooxolan-3-yl]pyrrolo[3,4-b]pyridine-5,7-dione (PubChem CID 92968054) has the molecular formula C13H12N2O4 and a molecular weight of 260.25 g/mol. Its IUPAC name is 6-[(3S)-5,5-dimethyl-2-oxooxolan-3-yl]pyrrolo[3,4-b]pyridine-5,7-dione.
| Compound Name | 6-[(3S)-5,5-dimethyl-2-oxooxolan-3-yl]pyrrolo[3,4-b]pyridine-5,7-dione |
|---|---|
| PubChem CID | 92968054 |
| Molecular Formula | C13H12N2O4 |
| Molecular Weight | 260.25 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | 6-[(3S)-5,5-dimethyl-2-oxooxolan-3-yl]pyrrolo[3,4-b]pyridine-5,7-dione |
| SMILES | CC1(C)C[C@H](N2C(=O)c3cccnc3C2=O)C(=O)O1 |
| InChI | InChI=1S/C13H12N2O4/c1-13(2)6-8(12(18)19-13)15-10(16)7-4-3-5-14-9(7)11(15)17/h3-5,8H,6H2,1-2H3/t8-/m0/s1 |
| InChIKey | HHFPUUXKZGIZFR-QMMMGPOBSA-N |
| XLogP | 0.77 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.25 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|