About (2S)-2-(4-bromophenyl)-2,4-dimethylmorpholine
(2S)-2-(4-bromophenyl)-2,4-dimethylmorpholine (PubChem CID 92968507) has the molecular formula C12H16BrNO
and a molecular weight of 270.17 g/mol. Its IUPAC name is (2S)-2-(4-bromophenyl)-2,4-dimethylmorpholine.
Molecular Properties
| Compound Name | (2S)-2-(4-bromophenyl)-2,4-dimethylmorpholine |
| PubChem CID | 92968507 |
| Molecular Formula | C12H16BrNO |
| Molecular Weight | 270.17 g/mol |
| Exact Mass | 269.04 |
| IUPAC Name | (2S)-2-(4-bromophenyl)-2,4-dimethylmorpholine |
| SMILES | CN1CCO[C@@](C)(c2ccc(Br)cc2)C1 |
| InChI | InChI=1S/C12H16BrNO/c1-12(9-14(2)7-8-15-12)10-3-5-11(13)6-4-10/h3-6H,7-9H2,1-2H3/t12-/m1/s1 |
| InChIKey | OYQNGONOBUSPLZ-GFCCVEGCSA-N |
| XLogP | 2.63 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.17 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S)-2-(4-bromophenyl)-2,4-dimethylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-(4-bromophenyl)-2,4-dimethylmorpholine?
The IUPAC name of (2S)-2-(4-bromophenyl)-2,4-dimethylmorpholine (CID 92968507) is (2S)-2-(4-bromophenyl)-2,4-dimethylmorpholine.
What is the SMILES notation for (2S)-2-(4-bromophenyl)-2,4-dimethylmorpholine?
The canonical SMILES for (2S)-2-(4-bromophenyl)-2,4-dimethylmorpholine is CN1CCO[C@@](C)(c2ccc(Br)cc2)C1.
What is the InChIKey of (2S)-2-(4-bromophenyl)-2,4-dimethylmorpholine?
The InChIKey is OYQNGONOBUSPLZ-GFCCVEGCSA-N. The full InChI is InChI=1S/C12H16BrNO/c1-12(9-14(2)7-8-15-12)10-3-5-11(13)6-4-10/h3-6H,7-9H2,1-2H3/t12-/m1/s1.
What are the key properties of (2S)-2-(4-bromophenyl)-2,4-dimethylmorpholine?
(2S)-2-(4-bromophenyl)-2,4-dimethylmorpholine has a molecular weight of 270.17 g/mol, XLogP of 2.63, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-(4-bromophenyl)-2,4-dimethylmorpholine is sourced from PubChem (CID 92968507), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).