C27H29F3N2O — CID 92973462
(Z,6R)-2-(4-tert-butylphenyl)-N-methoxy-6-methyl-1-[4-(trifluoromethyl)phenyl]-6,7-dihydro-5H-indol-4-imine (PubChem CID 92973462) has the molecular formula C27H29F3N2O and a molecular weight of 454.54 g/mol. Its IUPAC name is (Z,6R)-2-(4-tert-butylphenyl)-N-methoxy-6-methyl-1-[4-(trifluoromethyl)phenyl]-6,7-dihydro-5H-indol-4-imine.
| Compound Name | (Z,6R)-2-(4-tert-butylphenyl)-N-methoxy-6-methyl-1-[4-(trifluoromethyl)phenyl]-6,7-dihydro-5H-indol-4-imine |
|---|---|
| PubChem CID | 92973462 |
| Molecular Formula | C27H29F3N2O |
| Molecular Weight | 454.54 g/mol |
| Exact Mass | 454.22 |
| IUPAC Name | (Z,6R)-2-(4-tert-butylphenyl)-N-methoxy-6-methyl-1-[4-(trifluoromethyl)phenyl]-6,7-dihydro-5H-indol-4-imine |
| SMILES | CO/N=C1/C[C@H](C)Cc2c1cc(-c1ccc(C(C)(C)C)cc1)n2-c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C27H29F3N2O/c1-17-14-23(31-33-5)22-16-24(18-6-8-19(9-7-18)26(2,3)4)32(25(22)15-17)21-12-10-20(11-13-21)27(28,29)30/h6-13,16-17H,14-15H2,1-5H3/b31-23-/t17-/m0/s1 |
| InChIKey | HSWZHAZIUBRFCM-BMEHPIJJSA-N |
| XLogP | 7.39 |
| TPSA | 26.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.54 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|