C15H14N2O — CID 92974392
6-[(1S)-1-phenylethyl]-7H-pyrrolo[3,4-b]pyridin-5-one (PubChem CID 92974392) has the molecular formula C15H14N2O and a molecular weight of 238.29 g/mol. Its IUPAC name is 6-[(1S)-1-phenylethyl]-7H-pyrrolo[3,4-b]pyridin-5-one.
| Compound Name | 6-[(1S)-1-phenylethyl]-7H-pyrrolo[3,4-b]pyridin-5-one |
|---|---|
| PubChem CID | 92974392 |
| Molecular Formula | C15H14N2O |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | 6-[(1S)-1-phenylethyl]-7H-pyrrolo[3,4-b]pyridin-5-one |
| SMILES | C[C@@H](c1ccccc1)N1Cc2ncccc2C1=O |
| InChI | InChI=1S/C15H14N2O/c1-11(12-6-3-2-4-7-12)17-10-14-13(15(17)18)8-5-9-16-14/h2-9,11H,10H2,1H3/t11-/m0/s1 |
| InChIKey | BJBYZDRNVIYLJZ-NSHDSACASA-N |
| XLogP | 2.80 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |