C14H16N2 — CID 92974904
(4S)-1,2,3,4,5,6,7,8-octahydroacridine-4-carbonitrile (PubChem CID 92974904) has the molecular formula C14H16N2 and a molecular weight of 212.30 g/mol. Its IUPAC name is (4S)-1,2,3,4,5,6,7,8-octahydroacridine-4-carbonitrile.
| Compound Name | (4S)-1,2,3,4,5,6,7,8-octahydroacridine-4-carbonitrile |
|---|---|
| PubChem CID | 92974904 |
| Molecular Formula | C14H16N2 |
| Molecular Weight | 212.30 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | (4S)-1,2,3,4,5,6,7,8-octahydroacridine-4-carbonitrile |
| SMILES | N#C[C@H]1CCCc2cc3c(nc21)CCCC3 |
| InChI | InChI=1S/C14H16N2/c15-9-12-6-3-5-11-8-10-4-1-2-7-13(10)16-14(11)12/h8,12H,1-7H2/t12-/m1/s1 |
| InChIKey | SOJIKZOLOLHKOH-GFCCVEGCSA-N |
| XLogP | 2.90 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.30 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |