About (2S)-3,4-dihydro-2H-pyran-2-carboxamide
(2S)-3,4-dihydro-2H-pyran-2-carboxamide (PubChem CID 92975430) has the molecular formula C6H9NO2
and a molecular weight of 127.14 g/mol. Its IUPAC name is (2S)-3,4-dihydro-2H-pyran-2-carboxamide.
Molecular Properties
| Compound Name | (2S)-3,4-dihydro-2H-pyran-2-carboxamide |
| PubChem CID | 92975430 |
| Molecular Formula | C6H9NO2 |
| Molecular Weight | 127.14 g/mol |
| Exact Mass | 127.06 |
| IUPAC Name | (2S)-3,4-dihydro-2H-pyran-2-carboxamide |
| SMILES | NC(=O)[C@@H]1CCC=CO1 |
| InChI | InChI=1S/C6H9NO2/c7-6(8)5-3-1-2-4-9-5/h2,4-5H,1,3H2,(H2,7,8)/t5-/m0/s1 |
| InChIKey | ARLWMQMHHIPRCO-YFKPBYRVSA-N |
| XLogP | 0.16 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.14 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S)-3,4-dihydro-2H-pyran-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-3,4-dihydro-2H-pyran-2-carboxamide?
The IUPAC name of (2S)-3,4-dihydro-2H-pyran-2-carboxamide (CID 92975430) is (2S)-3,4-dihydro-2H-pyran-2-carboxamide.
What is the SMILES notation for (2S)-3,4-dihydro-2H-pyran-2-carboxamide?
The canonical SMILES for (2S)-3,4-dihydro-2H-pyran-2-carboxamide is NC(=O)[C@@H]1CCC=CO1.
What is the InChIKey of (2S)-3,4-dihydro-2H-pyran-2-carboxamide?
The InChIKey is ARLWMQMHHIPRCO-YFKPBYRVSA-N. The full InChI is InChI=1S/C6H9NO2/c7-6(8)5-3-1-2-4-9-5/h2,4-5H,1,3H2,(H2,7,8)/t5-/m0/s1.
What are the key properties of (2S)-3,4-dihydro-2H-pyran-2-carboxamide?
(2S)-3,4-dihydro-2H-pyran-2-carboxamide has a molecular weight of 127.14 g/mol, XLogP of 0.16, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-3,4-dihydro-2H-pyran-2-carboxamide is sourced from PubChem (CID 92975430), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).