About (7S)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-7-ol
(7S)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-7-ol (PubChem CID 92977143) has the molecular formula C6H8N2O
and a molecular weight of 124.14 g/mol. Its IUPAC name is (7S)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-7-ol.
Molecular Properties
| Compound Name | (7S)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-7-ol |
| PubChem CID | 92977143 |
| Molecular Formula | C6H8N2O |
| Molecular Weight | 124.14 g/mol |
| Exact Mass | 124.06 |
| IUPAC Name | (7S)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-7-ol |
| SMILES | O[C@H]1CCn2ccnc21 |
| InChI | InChI=1S/C6H8N2O/c9-5-1-3-8-4-2-7-6(5)8/h2,4-5,9H,1,3H2/t5-/m0/s1 |
| InChIKey | ZNTOIYUPLXOHAS-YFKPBYRVSA-N |
| XLogP | 0.32 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.14 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (7S)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-7-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7S)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-7-ol?
The IUPAC name of (7S)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-7-ol (CID 92977143) is (7S)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-7-ol.
What is the SMILES notation for (7S)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-7-ol?
The canonical SMILES for (7S)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-7-ol is O[C@H]1CCn2ccnc21.
What is the InChIKey of (7S)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-7-ol?
The InChIKey is ZNTOIYUPLXOHAS-YFKPBYRVSA-N. The full InChI is InChI=1S/C6H8N2O/c9-5-1-3-8-4-2-7-6(5)8/h2,4-5,9H,1,3H2/t5-/m0/s1.
What are the key properties of (7S)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-7-ol?
(7S)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-7-ol has a molecular weight of 124.14 g/mol, XLogP of 0.32, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (7S)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-7-ol is sourced from PubChem (CID 92977143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).