C5H7ClF3N — CID 92980357
trans-(1R,2R)-2-chloro-2,3,3-trifluoro-1-methylcyclobutan-1-amine (PubChem CID 92980357) has the molecular formula C5H7ClF3N and a molecular weight of 173.56 g/mol. Its IUPAC name is trans-(1R,2R)-2-chloro-2,3,3-trifluoro-1-methylcyclobutan-1-amine.
| Compound Name | trans-(1R,2R)-2-chloro-2,3,3-trifluoro-1-methylcyclobutan-1-amine |
|---|---|
| PubChem CID | 92980357 |
| Molecular Formula | C5H7ClF3N |
| Molecular Weight | 173.56 g/mol |
| Exact Mass | 173.02 |
| IUPAC Name | trans-(1R,2R)-2-chloro-2,3,3-trifluoro-1-methylcyclobutan-1-amine |
| SMILES | C[C@@]1(N)CC(F)(F)[C@]1(F)Cl |
| InChI | InChI=1S/C5H7ClF3N/c1-3(10)2-4(7,8)5(3,6)9/h2,10H2,1H3/t3-,5+/m1/s1 |
| InChIKey | XEYYCHMTHKYPKF-WUJLRWPWSA-N |
| XLogP | 1.65 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.56 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|