C9H9F3O2 — CID 92980365
(1S,2S,4S)-2-(trifluoromethyl)bicyclo[2.2.1]hept-5-ene-2-carboxylic acid (PubChem CID 92980365) has the molecular formula C9H9F3O2 and a molecular weight of 206.16 g/mol. Its IUPAC name is (1S,2S,4S)-2-(trifluoromethyl)bicyclo[2.2.1]hept-5-ene-2-carboxylic acid.
| Compound Name | (1S,2S,4S)-2-(trifluoromethyl)bicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 92980365 |
| Molecular Formula | C9H9F3O2 |
| Molecular Weight | 206.16 g/mol |
| Exact Mass | 206.06 |
| IUPAC Name | (1S,2S,4S)-2-(trifluoromethyl)bicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
| SMILES | O=C(O)[C@]1(C(F)(F)F)C[C@H]2C=C[C@@H]1C2 |
| InChI | InChI=1S/C9H9F3O2/c10-9(11,12)8(7(13)14)4-5-1-2-6(8)3-5/h1-2,5-6H,3-4H2,(H,13,14)/t5-,6+,8-/m0/s1 |
| InChIKey | IVQQRSCSISNRNA-BBVRLYRLSA-N |
| XLogP | 2.22 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.16 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|