About 1-[[(2S,5S)-1-benzyl-5-methylpyrrolidin-2-yl]methyl]-2-methylindole
1-[[(2S,5S)-1-benzyl-5-methylpyrrolidin-2-yl]methyl]-2-methylindole (PubChem CID 92981292) has the molecular formula C22H26N2
and a molecular weight of 318.46 g/mol. Its IUPAC name is 1-[[(2S,5S)-1-benzyl-5-methylpyrrolidin-2-yl]methyl]-2-methylindole.
Molecular Properties
| Compound Name | 1-[[(2S,5S)-1-benzyl-5-methylpyrrolidin-2-yl]methyl]-2-methylindole |
| PubChem CID | 92981292 |
| Molecular Formula | C22H26N2 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.21 |
| IUPAC Name | 1-[[(2S,5S)-1-benzyl-5-methylpyrrolidin-2-yl]methyl]-2-methylindole |
| SMILES | Cc1cc2ccccc2n1C[C@@H]1CC[C@H](C)N1Cc1ccccc1 |
| InChI | InChI=1S/C22H26N2/c1-17-12-13-21(23(17)15-19-8-4-3-5-9-19)16-24-18(2)14-20-10-6-7-11-22(20)24/h3-11,14,17,21H,12-13,15-16H2,1-2H3/t17-,21-/m0/s1 |
| InChIKey | JPUISJVBIQPKHP-UWJYYQICSA-N |
| XLogP | 5.00 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[[(2S,5S)-1-benzyl-5-methylpyrrolidin-2-yl]methyl]-2-methylindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[(2S,5S)-1-benzyl-5-methylpyrrolidin-2-yl]methyl]-2-methylindole?
The IUPAC name of 1-[[(2S,5S)-1-benzyl-5-methylpyrrolidin-2-yl]methyl]-2-methylindole (CID 92981292) is 1-[[(2S,5S)-1-benzyl-5-methylpyrrolidin-2-yl]methyl]-2-methylindole.
What is the SMILES notation for 1-[[(2S,5S)-1-benzyl-5-methylpyrrolidin-2-yl]methyl]-2-methylindole?
The canonical SMILES for 1-[[(2S,5S)-1-benzyl-5-methylpyrrolidin-2-yl]methyl]-2-methylindole is Cc1cc2ccccc2n1C[C@@H]1CC[C@H](C)N1Cc1ccccc1.
What is the InChIKey of 1-[[(2S,5S)-1-benzyl-5-methylpyrrolidin-2-yl]methyl]-2-methylindole?
The InChIKey is JPUISJVBIQPKHP-UWJYYQICSA-N. The full InChI is InChI=1S/C22H26N2/c1-17-12-13-21(23(17)15-19-8-4-3-5-9-19)16-24-18(2)14-20-10-6-7-11-22(20)24/h3-11,14,17,21H,12-13,15-16H2,1-2H3/t17-,21-/m0/s1.
What are the key properties of 1-[[(2S,5S)-1-benzyl-5-methylpyrrolidin-2-yl]methyl]-2-methylindole?
1-[[(2S,5S)-1-benzyl-5-methylpyrrolidin-2-yl]methyl]-2-methylindole has a molecular weight of 318.46 g/mol, XLogP of 5.00, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[(2S,5S)-1-benzyl-5-methylpyrrolidin-2-yl]methyl]-2-methylindole is sourced from PubChem (CID 92981292), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).