C16H23N3O4 — CID 9298171
[(2R)-1-(tert-butylcarbamoylamino)-1-oxopropan-2-yl] 3-amino-4-methylbenzoate (PubChem CID 9298171) has the molecular formula C16H23N3O4 and a molecular weight of 321.38 g/mol. Its IUPAC name is [(2R)-1-(tert-butylcarbamoylamino)-1-oxopropan-2-yl] 3-amino-4-methylbenzoate.
| Compound Name | [(2R)-1-(tert-butylcarbamoylamino)-1-oxopropan-2-yl] 3-amino-4-methylbenzoate |
|---|---|
| PubChem CID | 9298171 |
| Molecular Formula | C16H23N3O4 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | [(2R)-1-(tert-butylcarbamoylamino)-1-oxopropan-2-yl] 3-amino-4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)O[C@H](C)C(=O)NC(=O)NC(C)(C)C)cc1N |
| InChI | InChI=1S/C16H23N3O4/c1-9-6-7-11(8-12(9)17)14(21)23-10(2)13(20)18-15(22)19-16(3,4)5/h6-8,10H,17H2,1-5H3,(H2,18,19,20,22)/t10-/m1/s1 |
| InChIKey | TYVODIKVCPADKB-SNVBAGLBSA-N |
| XLogP | 1.75 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|