About (2S)-2-imidazo[1,2-a]pyridin-6-ylcyclohexan-1-one
(2S)-2-imidazo[1,2-a]pyridin-6-ylcyclohexan-1-one (PubChem CID 92982225) has the molecular formula C13H14N2O
and a molecular weight of 214.27 g/mol. Its IUPAC name is (2S)-2-imidazo[1,2-a]pyridin-6-ylcyclohexan-1-one.
Molecular Properties
| Compound Name | (2S)-2-imidazo[1,2-a]pyridin-6-ylcyclohexan-1-one |
| PubChem CID | 92982225 |
| Molecular Formula | C13H14N2O |
| Molecular Weight | 214.27 g/mol |
| Exact Mass | 214.11 |
| IUPAC Name | (2S)-2-imidazo[1,2-a]pyridin-6-ylcyclohexan-1-one |
| SMILES | O=C1CCCC[C@H]1c1ccc2nccn2c1 |
| InChI | InChI=1S/C13H14N2O/c16-12-4-2-1-3-11(12)10-5-6-13-14-7-8-15(13)9-10/h5-9,11H,1-4H2/t11-/m0/s1 |
| InChIKey | UVUOVBKYCRDAHA-NSHDSACASA-N |
| XLogP | 2.56 |
| TPSA | 34.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.27 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2S)-2-imidazo[1,2-a]pyridin-6-ylcyclohexan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-imidazo[1,2-a]pyridin-6-ylcyclohexan-1-one?
The IUPAC name of (2S)-2-imidazo[1,2-a]pyridin-6-ylcyclohexan-1-one (CID 92982225) is (2S)-2-imidazo[1,2-a]pyridin-6-ylcyclohexan-1-one.
What is the SMILES notation for (2S)-2-imidazo[1,2-a]pyridin-6-ylcyclohexan-1-one?
The canonical SMILES for (2S)-2-imidazo[1,2-a]pyridin-6-ylcyclohexan-1-one is O=C1CCCC[C@H]1c1ccc2nccn2c1.
What is the InChIKey of (2S)-2-imidazo[1,2-a]pyridin-6-ylcyclohexan-1-one?
The InChIKey is UVUOVBKYCRDAHA-NSHDSACASA-N. The full InChI is InChI=1S/C13H14N2O/c16-12-4-2-1-3-11(12)10-5-6-13-14-7-8-15(13)9-10/h5-9,11H,1-4H2/t11-/m0/s1.
What are the key properties of (2S)-2-imidazo[1,2-a]pyridin-6-ylcyclohexan-1-one?
(2S)-2-imidazo[1,2-a]pyridin-6-ylcyclohexan-1-one has a molecular weight of 214.27 g/mol, XLogP of 2.56, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-imidazo[1,2-a]pyridin-6-ylcyclohexan-1-one is sourced from PubChem (CID 92982225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).