C18H18ClN3O2 — CID 92985896
(3R)-1-(3-chloro-4-methylphenyl)-2-oxo-N-(pyridin-2-ylmethyl)pyrrolidine-3-carboxamide (PubChem CID 92985896) has the molecular formula C18H18ClN3O2 and a molecular weight of 343.81 g/mol. Its IUPAC name is (3R)-1-(3-chloro-4-methylphenyl)-2-oxo-N-(pyridin-2-ylmethyl)pyrrolidine-3-carboxamide.
| Compound Name | (3R)-1-(3-chloro-4-methylphenyl)-2-oxo-N-(pyridin-2-ylmethyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 92985896 |
| Molecular Formula | C18H18ClN3O2 |
| Molecular Weight | 343.81 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | (3R)-1-(3-chloro-4-methylphenyl)-2-oxo-N-(pyridin-2-ylmethyl)pyrrolidine-3-carboxamide |
| SMILES | Cc1ccc(N2CC[C@H](C(=O)NCc3ccccn3)C2=O)cc1Cl |
| InChI | InChI=1S/C18H18ClN3O2/c1-12-5-6-14(10-16(12)19)22-9-7-15(18(22)24)17(23)21-11-13-4-2-3-8-20-13/h2-6,8,10,15H,7,9,11H2,1H3,(H,21,23)/t15-/m1/s1 |
| InChIKey | DNCFQZBNNPHIGS-OAHLLOKOSA-N |
| XLogP | 2.71 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.81 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|