C20H21NO4 — CID 9298633
methyl 4-[cyclopropyl-[(4-methoxyphenyl)methyl]carbamoyl]benzoate (PubChem CID 9298633) has the molecular formula C20H21NO4 and a molecular weight of 339.39 g/mol. Its IUPAC name is methyl 4-[cyclopropyl-[(4-methoxyphenyl)methyl]carbamoyl]benzoate.
| Compound Name | methyl 4-[cyclopropyl-[(4-methoxyphenyl)methyl]carbamoyl]benzoate |
|---|---|
| PubChem CID | 9298633 |
| Molecular Formula | C20H21NO4 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | methyl 4-[cyclopropyl-[(4-methoxyphenyl)methyl]carbamoyl]benzoate |
| SMILES | COC(=O)c1ccc(C(=O)N(Cc2ccc(OC)cc2)C2CC2)cc1 |
| InChI | InChI=1S/C20H21NO4/c1-24-18-11-3-14(4-12-18)13-21(17-9-10-17)19(22)15-5-7-16(8-6-15)20(23)25-2/h3-8,11-12,17H,9-10,13H2,1-2H3 |
| InChIKey | QUEDSWAGPPQSHU-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |