C23H29FN2O2 — CID 92996098
(3S,5R)-1-[(3-fluorophenyl)methyl]-N-(2-methoxyethyl)-5-(3-methylphenyl)piperidine-3-carboxamide (PubChem CID 92996098) has the molecular formula C23H29FN2O2 and a molecular weight of 384.50 g/mol. Its IUPAC name is (3S,5R)-1-[(3-fluorophenyl)methyl]-N-(2-methoxyethyl)-5-(3-methylphenyl)piperidine-3-carboxamide.
| Compound Name | (3S,5R)-1-[(3-fluorophenyl)methyl]-N-(2-methoxyethyl)-5-(3-methylphenyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 92996098 |
| Molecular Formula | C23H29FN2O2 |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.22 |
| IUPAC Name | (3S,5R)-1-[(3-fluorophenyl)methyl]-N-(2-methoxyethyl)-5-(3-methylphenyl)piperidine-3-carboxamide |
| SMILES | COCCNC(=O)[C@H]1C[C@H](c2cccc(C)c2)CN(Cc2cccc(F)c2)C1 |
| InChI | InChI=1S/C23H29FN2O2/c1-17-5-3-7-19(11-17)20-13-21(23(27)25-9-10-28-2)16-26(15-20)14-18-6-4-8-22(24)12-18/h3-8,11-12,20-21H,9-10,13-16H2,1-2H3,(H,25,27)/t20-,21-/m0/s1 |
| InChIKey | CINZEBRIRCLFOI-SFTDATJTSA-N |
| XLogP | 3.50 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|