C17H22N2OS — CID 9299993
3-cyclopentylspiro[1H-quinazoline-2,4'-thiane]-4-one (PubChem CID 9299993) has the molecular formula C17H22N2OS and a molecular weight of 302.44 g/mol. Its IUPAC name is 3-cyclopentylspiro[1H-quinazoline-2,4'-thiane]-4-one.
| Compound Name | 3-cyclopentylspiro[1H-quinazoline-2,4'-thiane]-4-one |
|---|---|
| PubChem CID | 9299993 |
| Molecular Formula | C17H22N2OS |
| Molecular Weight | 302.44 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | 3-cyclopentylspiro[1H-quinazoline-2,4'-thiane]-4-one |
| SMILES | O=C1c2ccccc2NC2(CCSCC2)N1C1CCCC1 |
| InChI | InChI=1S/C17H22N2OS/c20-16-14-7-3-4-8-15(14)18-17(9-11-21-12-10-17)19(16)13-5-1-2-6-13/h3-4,7-8,13,18H,1-2,5-6,9-12H2 |
| InChIKey | HCQRRXZGDQSKJP-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.44 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |