About 3-cyclopentylspiro[1H-quinazoline-2,4'-thiane]-4-one
3-cyclopentylspiro[1H-quinazoline-2,4'-thiane]-4-one (PubChem CID 9299993) has the molecular formula C17H22N2OS
and a molecular weight of 302.44 g/mol. Its IUPAC name is 3-cyclopentylspiro[1H-quinazoline-2,4'-thiane]-4-one.
Molecular Properties
| Compound Name | 3-cyclopentylspiro[1H-quinazoline-2,4'-thiane]-4-one |
| PubChem CID | 9299993 |
| Molecular Formula | C17H22N2OS |
| Molecular Weight | 302.44 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | 3-cyclopentylspiro[1H-quinazoline-2,4'-thiane]-4-one |
| SMILES | O=C1c2ccccc2NC2(CCSCC2)N1C1CCCC1 |
| InChI | InChI=1S/C17H22N2OS/c20-16-14-7-3-4-8-15(14)18-17(9-11-21-12-10-17)19(16)13-5-1-2-6-13/h3-4,7-8,13,18H,1-2,5-6,9-12H2 |
| InChIKey | HCQRRXZGDQSKJP-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.44 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-cyclopentylspiro[1H-quinazoline-2,4'-thiane]-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclopentylspiro[1H-quinazoline-2,4'-thiane]-4-one?
The IUPAC name of 3-cyclopentylspiro[1H-quinazoline-2,4'-thiane]-4-one (CID 9299993) is 3-cyclopentylspiro[1H-quinazoline-2,4'-thiane]-4-one.
What is the SMILES notation for 3-cyclopentylspiro[1H-quinazoline-2,4'-thiane]-4-one?
The canonical SMILES for 3-cyclopentylspiro[1H-quinazoline-2,4'-thiane]-4-one is O=C1c2ccccc2NC2(CCSCC2)N1C1CCCC1.
What is the InChIKey of 3-cyclopentylspiro[1H-quinazoline-2,4'-thiane]-4-one?
The InChIKey is HCQRRXZGDQSKJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22N2OS/c20-16-14-7-3-4-8-15(14)18-17(9-11-21-12-10-17)19(16)13-5-1-2-6-13/h3-4,7-8,13,18H,1-2,5-6,9-12H2.
What are the key properties of 3-cyclopentylspiro[1H-quinazoline-2,4'-thiane]-4-one?
3-cyclopentylspiro[1H-quinazoline-2,4'-thiane]-4-one has a molecular weight of 302.44 g/mol, XLogP of 3.72, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclopentylspiro[1H-quinazoline-2,4'-thiane]-4-one is sourced from PubChem (CID 9299993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).