C27H38FN3O — CID 93001186
N-[[(3R,4S)-1-[[4-(dimethylamino)phenyl]methyl]-4-(3-fluorophenyl)pyrrolidin-3-yl]methyl]-2-methyl-N-propan-2-ylpropanamide (PubChem CID 93001186) has the molecular formula C27H38FN3O and a molecular weight of 439.62 g/mol. Its IUPAC name is N-[[(3R,4S)-1-[[4-(dimethylamino)phenyl]methyl]-4-(3-fluorophenyl)pyrrolidin-3-yl]methyl]-2-methyl-N-propan-2-ylpropanamide.
| Compound Name | N-[[(3R,4S)-1-[[4-(dimethylamino)phenyl]methyl]-4-(3-fluorophenyl)pyrrolidin-3-yl]methyl]-2-methyl-N-propan-2-ylpropanamide |
|---|---|
| PubChem CID | 93001186 |
| Molecular Formula | C27H38FN3O |
| Molecular Weight | 439.62 g/mol |
| Exact Mass | 439.30 |
| IUPAC Name | N-[[(3R,4S)-1-[[4-(dimethylamino)phenyl]methyl]-4-(3-fluorophenyl)pyrrolidin-3-yl]methyl]-2-methyl-N-propan-2-ylpropanamide |
| SMILES | CC(C)C(=O)N(C[C@H]1CN(Cc2ccc(N(C)C)cc2)C[C@@H]1c1cccc(F)c1)C(C)C |
| InChI | InChI=1S/C27H38FN3O/c1-19(2)27(32)31(20(3)4)17-23-16-30(15-21-10-12-25(13-11-21)29(5)6)18-26(23)22-8-7-9-24(28)14-22/h7-14,19-20,23,26H,15-18H2,1-6H3/t23-,26-/m1/s1 |
| InChIKey | ZOJNKXBHUINZCU-ZEQKJWHPSA-N |
| XLogP | 5.00 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.62 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|