C10H22N2O — CID 93001596
(2R,3R)-2-amino-N-[(2S)-butan-2-yl]-3-methylpentanamide (PubChem CID 93001596) has the molecular formula C10H22N2O and a molecular weight of 186.30 g/mol. Its IUPAC name is (2R,3R)-2-amino-N-[(2S)-butan-2-yl]-3-methylpentanamide.
| Compound Name | (2R,3R)-2-amino-N-[(2S)-butan-2-yl]-3-methylpentanamide |
|---|---|
| PubChem CID | 93001596 |
| Molecular Formula | C10H22N2O |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.17 |
| IUPAC Name | (2R,3R)-2-amino-N-[(2S)-butan-2-yl]-3-methylpentanamide |
| SMILES | CC[C@@H](C)[C@@H](N)C(=O)N[C@@H](C)CC |
| InChI | InChI=1S/C10H22N2O/c1-5-7(3)9(11)10(13)12-8(4)6-2/h7-9H,5-6,11H2,1-4H3,(H,12,13)/t7-,8+,9-/m1/s1 |
| InChIKey | MGGGBJJNLFCEPU-HRDYMLBCSA-N |
| XLogP | 1.27 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |