C19H16N6O2S — CID 9300857
3-[(3-methoxyphenoxy)methyl]-4-[(Z)-quinoxalin-2-ylmethylideneamino]-1H-1,2,4-triazole-5-thione (PubChem CID 9300857) has the molecular formula C19H16N6O2S and a molecular weight of 392.44 g/mol. Its IUPAC name is 3-[(3-methoxyphenoxy)methyl]-4-[(Z)-quinoxalin-2-ylmethylideneamino]-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-[(3-methoxyphenoxy)methyl]-4-[(Z)-quinoxalin-2-ylmethylideneamino]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 9300857 |
| Molecular Formula | C19H16N6O2S |
| Molecular Weight | 392.44 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | 3-[(3-methoxyphenoxy)methyl]-4-[(Z)-quinoxalin-2-ylmethylideneamino]-1H-1,2,4-triazole-5-thione |
| SMILES | COc1cccc(OCc2n[nH]c(=S)n2/N=C\c2cnc3ccccc3n2)c1 |
| InChI | InChI=1S/C19H16N6O2S/c1-26-14-5-4-6-15(9-14)27-12-18-23-24-19(28)25(18)21-11-13-10-20-16-7-2-3-8-17(16)22-13/h2-11H,12H2,1H3,(H,24,28)/b21-11- |
| InChIKey | NCCJHMKQBJQZHX-NHDPSOOVSA-N |
| XLogP | 3.35 |
| TPSA | 90.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.44 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|