C30H25N3O4 — CID 93009673
(1S,2R,3aR)-2-(3,4-dimethoxyphenyl)-1-(4-methoxybenzoyl)-2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3,3-dicarbonitrile (PubChem CID 93009673) has the molecular formula C30H25N3O4 and a molecular weight of 491.55 g/mol. Its IUPAC name is (1S,2R,3aR)-2-(3,4-dimethoxyphenyl)-1-(4-methoxybenzoyl)-2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3,3-dicarbonitrile.
| Compound Name | (1S,2R,3aR)-2-(3,4-dimethoxyphenyl)-1-(4-methoxybenzoyl)-2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3,3-dicarbonitrile |
|---|---|
| PubChem CID | 93009673 |
| Molecular Formula | C30H25N3O4 |
| Molecular Weight | 491.55 g/mol |
| Exact Mass | 491.18 |
| IUPAC Name | (1S,2R,3aR)-2-(3,4-dimethoxyphenyl)-1-(4-methoxybenzoyl)-2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3,3-dicarbonitrile |
| SMILES | COc1ccc(C(=O)[C@@H]2[C@H](c3ccc(OC)c(OC)c3)C(C#N)(C#N)[C@H]3C=Cc4ccccc4N23)cc1 |
| InChI | InChI=1S/C30H25N3O4/c1-35-22-12-8-20(9-13-22)29(34)28-27(21-10-14-24(36-2)25(16-21)37-3)30(17-31,18-32)26-15-11-19-6-4-5-7-23(19)33(26)28/h4-16,26-28H,1-3H3/t26-,27+,28+/m1/s1 |
| InChIKey | GECQGQHOIGYOKE-PKTNWEFCSA-N |
| XLogP | 5.00 |
| TPSA | 95.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.55 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |