C31H33N3O4 — CID 93013252
(6S)-N-[2-(3,4-dimethoxyphenyl)ethyl]-N-methyl-6-(4-phenoxyphenyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-2-carboxamide (PubChem CID 93013252) has the molecular formula C31H33N3O4 and a molecular weight of 511.62 g/mol. Its IUPAC name is (6S)-N-[2-(3,4-dimethoxyphenyl)ethyl]-N-methyl-6-(4-phenoxyphenyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-2-carboxamide.
| Compound Name | (6S)-N-[2-(3,4-dimethoxyphenyl)ethyl]-N-methyl-6-(4-phenoxyphenyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 93013252 |
| Molecular Formula | C31H33N3O4 |
| Molecular Weight | 511.62 g/mol |
| Exact Mass | 511.25 |
| IUPAC Name | (6S)-N-[2-(3,4-dimethoxyphenyl)ethyl]-N-methyl-6-(4-phenoxyphenyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-2-carboxamide |
| SMILES | COc1ccc(CCN(C)C(=O)c2cn3c(n2)CC[C@@H](c2ccc(Oc4ccccc4)cc2)C3)cc1OC |
| InChI | InChI=1S/C31H33N3O4/c1-33(18-17-22-9-15-28(36-2)29(19-22)37-3)31(35)27-21-34-20-24(12-16-30(34)32-27)23-10-13-26(14-11-23)38-25-7-5-4-6-8-25/h4-11,13-15,19,21,24H,12,16-18,20H2,1-3H3/t24-/m1/s1 |
| InChIKey | AWPZTVQNPSGJOJ-XMMPIXPASA-N |
| XLogP | 5.74 |
| TPSA | 65.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.62 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |