C29H36N4O2 — CID 93013428
(6R)-N-(1-benzylpiperidin-4-yl)-6-(4-methoxy-3,5-dimethylphenyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-2-carboxamide (PubChem CID 93013428) has the molecular formula C29H36N4O2 and a molecular weight of 472.63 g/mol. Its IUPAC name is (6R)-N-(1-benzylpiperidin-4-yl)-6-(4-methoxy-3,5-dimethylphenyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-2-carboxamide.
| Compound Name | (6R)-N-(1-benzylpiperidin-4-yl)-6-(4-methoxy-3,5-dimethylphenyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 93013428 |
| Molecular Formula | C29H36N4O2 |
| Molecular Weight | 472.63 g/mol |
| Exact Mass | 472.28 |
| IUPAC Name | (6R)-N-(1-benzylpiperidin-4-yl)-6-(4-methoxy-3,5-dimethylphenyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-2-carboxamide |
| SMILES | COc1c(C)cc([C@H]2CCc3nc(C(=O)NC4CCN(Cc5ccccc5)CC4)cn3C2)cc1C |
| InChI | InChI=1S/C29H36N4O2/c1-20-15-24(16-21(2)28(20)35-3)23-9-10-27-31-26(19-33(27)18-23)29(34)30-25-11-13-32(14-12-25)17-22-7-5-4-6-8-22/h4-8,15-16,19,23,25H,9-14,17-18H2,1-3H3,(H,30,34)/t23-/m0/s1 |
| InChIKey | AUXHFAOCXVTJBF-QHCPKHFHSA-N |
| XLogP | 4.63 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.63 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |