C23H25ClN2O2 — CID 93020422
(3R,4S)-2-butyl-3-(3-chlorophenyl)-1-oxo-N-prop-2-enyl-3,4-dihydroisoquinoline-4-carboxamide (PubChem CID 93020422) has the molecular formula C23H25ClN2O2 and a molecular weight of 396.92 g/mol. Its IUPAC name is (3R,4S)-2-butyl-3-(3-chlorophenyl)-1-oxo-N-prop-2-enyl-3,4-dihydroisoquinoline-4-carboxamide.
| Compound Name | (3R,4S)-2-butyl-3-(3-chlorophenyl)-1-oxo-N-prop-2-enyl-3,4-dihydroisoquinoline-4-carboxamide |
|---|---|
| PubChem CID | 93020422 |
| Molecular Formula | C23H25ClN2O2 |
| Molecular Weight | 396.92 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | (3R,4S)-2-butyl-3-(3-chlorophenyl)-1-oxo-N-prop-2-enyl-3,4-dihydroisoquinoline-4-carboxamide |
| SMILES | C=CCNC(=O)[C@H]1c2ccccc2C(=O)N(CCCC)[C@H]1c1cccc(Cl)c1 |
| InChI | InChI=1S/C23H25ClN2O2/c1-3-5-14-26-21(16-9-8-10-17(24)15-16)20(22(27)25-13-4-2)18-11-6-7-12-19(18)23(26)28/h4,6-12,15,20-21H,2-3,5,13-14H2,1H3,(H,25,27)/t20-,21-/m0/s1 |
| InChIKey | QXNDPGSEVHPYON-SFTDATJTSA-N |
| XLogP | 4.72 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.92 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|