C29H30N2O4 — CID 93020563
(3S,4S)-3-(1,3-benzodioxol-5-yl)-1-oxo-N-(3-phenylpropyl)-2-propyl-3,4-dihydroisoquinoline-4-carboxamide (PubChem CID 93020563) has the molecular formula C29H30N2O4 and a molecular weight of 470.57 g/mol. Its IUPAC name is (3S,4S)-3-(1,3-benzodioxol-5-yl)-1-oxo-N-(3-phenylpropyl)-2-propyl-3,4-dihydroisoquinoline-4-carboxamide.
| Compound Name | (3S,4S)-3-(1,3-benzodioxol-5-yl)-1-oxo-N-(3-phenylpropyl)-2-propyl-3,4-dihydroisoquinoline-4-carboxamide |
|---|---|
| PubChem CID | 93020563 |
| Molecular Formula | C29H30N2O4 |
| Molecular Weight | 470.57 g/mol |
| Exact Mass | 470.22 |
| IUPAC Name | (3S,4S)-3-(1,3-benzodioxol-5-yl)-1-oxo-N-(3-phenylpropyl)-2-propyl-3,4-dihydroisoquinoline-4-carboxamide |
| SMILES | CCCN1C(=O)c2ccccc2[C@H](C(=O)NCCCc2ccccc2)[C@H]1c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C29H30N2O4/c1-2-17-31-27(21-14-15-24-25(18-21)35-19-34-24)26(22-12-6-7-13-23(22)29(31)33)28(32)30-16-8-11-20-9-4-3-5-10-20/h3-7,9-10,12-15,18,26-27H,2,8,11,16-17,19H2,1H3,(H,30,32)/t26-,27+/m0/s1 |
| InChIKey | QVYAGKAFYCTPBK-RRPNLBNLSA-N |
| XLogP | 4.86 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.57 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|