C14H14N4 — CID 93022969
(4S,4aS)-2-amino-4-methyl-4a,5,6,7-tetrahydro-4H-naphthalene-1,3,3-tricarbonitrile (PubChem CID 93022969) has the molecular formula C14H14N4 and a molecular weight of 238.29 g/mol. Its IUPAC name is (4S,4aS)-2-amino-4-methyl-4a,5,6,7-tetrahydro-4H-naphthalene-1,3,3-tricarbonitrile.
| Compound Name | (4S,4aS)-2-amino-4-methyl-4a,5,6,7-tetrahydro-4H-naphthalene-1,3,3-tricarbonitrile |
|---|---|
| PubChem CID | 93022969 |
| Molecular Formula | C14H14N4 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | (4S,4aS)-2-amino-4-methyl-4a,5,6,7-tetrahydro-4H-naphthalene-1,3,3-tricarbonitrile |
| SMILES | C[C@H]1[C@@H]2CCCC=C2C(C#N)=C(N)C1(C#N)C#N |
| InChI | InChI=1S/C14H14N4/c1-9-10-4-2-3-5-11(10)12(6-15)13(18)14(9,7-16)8-17/h5,9-10H,2-4,18H2,1H3/t9-,10-/m0/s1 |
| InChIKey | YXMKLHORHYXDGR-UWVGGRQHSA-N |
| XLogP | 2.13 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyano_ene_amine_A(56)', 'substructure': 'N/A'} |
|---|