C10H12F3NO3 — CID 93034388
(1S,6R)-6-(2,2,2-trifluoroethylcarbamoyl)cyclohex-3-ene-1-carboxylic acid (PubChem CID 93034388) has the molecular formula C10H12F3NO3 and a molecular weight of 251.20 g/mol. Its IUPAC name is (1S,6R)-6-(2,2,2-trifluoroethylcarbamoyl)cyclohex-3-ene-1-carboxylic acid.
| Compound Name | (1S,6R)-6-(2,2,2-trifluoroethylcarbamoyl)cyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 93034388 |
| Molecular Formula | C10H12F3NO3 |
| Molecular Weight | 251.20 g/mol |
| Exact Mass | 251.08 |
| IUPAC Name | (1S,6R)-6-(2,2,2-trifluoroethylcarbamoyl)cyclohex-3-ene-1-carboxylic acid |
| SMILES | O=C(O)[C@H]1CC=CC[C@H]1C(=O)NCC(F)(F)F |
| InChI | InChI=1S/C10H12F3NO3/c11-10(12,13)5-14-8(15)6-3-1-2-4-7(6)9(16)17/h1-2,6-7H,3-5H2,(H,14,15)(H,16,17)/t6-,7+/m1/s1 |
| InChIKey | MHEHUKOVRHAGDC-RQJHMYQMSA-N |
| XLogP | 1.33 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.20 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|