C22H18FNO4 — CID 93036575
(4R)-1-(3-fluorophenyl)-4-(4-prop-2-enoxyphenyl)-4,7-dihydro-3H-furo[3,4-b]pyridine-2,5-dione (PubChem CID 93036575) has the molecular formula C22H18FNO4 and a molecular weight of 379.39 g/mol. Its IUPAC name is (4R)-1-(3-fluorophenyl)-4-(4-prop-2-enoxyphenyl)-4,7-dihydro-3H-furo[3,4-b]pyridine-2,5-dione.
| Compound Name | (4R)-1-(3-fluorophenyl)-4-(4-prop-2-enoxyphenyl)-4,7-dihydro-3H-furo[3,4-b]pyridine-2,5-dione |
|---|---|
| PubChem CID | 93036575 |
| Molecular Formula | C22H18FNO4 |
| Molecular Weight | 379.39 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | (4R)-1-(3-fluorophenyl)-4-(4-prop-2-enoxyphenyl)-4,7-dihydro-3H-furo[3,4-b]pyridine-2,5-dione |
| SMILES | C=CCOc1ccc([C@H]2CC(=O)N(c3cccc(F)c3)C3=C2C(=O)OC3)cc1 |
| InChI | InChI=1S/C22H18FNO4/c1-2-10-27-17-8-6-14(7-9-17)18-12-20(25)24(16-5-3-4-15(23)11-16)19-13-28-22(26)21(18)19/h2-9,11,18H,1,10,12-13H2/t18-/m1/s1 |
| InChIKey | IXLQCQOILWTYEI-GOSISDBHSA-N |
| XLogP | 3.72 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.39 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|