C14H18N2O4S — CID 93039678
methyl (2R)-1-[(2S)-2-(thiophene-2-carbonylamino)propanoyl]pyrrolidine-2-carboxylate (PubChem CID 93039678) has the molecular formula C14H18N2O4S and a molecular weight of 310.38 g/mol. Its IUPAC name is methyl (2R)-1-[(2S)-2-(thiophene-2-carbonylamino)propanoyl]pyrrolidine-2-carboxylate.
| Compound Name | methyl (2R)-1-[(2S)-2-(thiophene-2-carbonylamino)propanoyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 93039678 |
| Molecular Formula | C14H18N2O4S |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | methyl (2R)-1-[(2S)-2-(thiophene-2-carbonylamino)propanoyl]pyrrolidine-2-carboxylate |
| SMILES | COC(=O)[C@H]1CCCN1C(=O)[C@H](C)NC(=O)c1cccs1 |
| InChI | InChI=1S/C14H18N2O4S/c1-9(15-12(17)11-6-4-8-21-11)13(18)16-7-3-5-10(16)14(19)20-2/h4,6,8-10H,3,5,7H2,1-2H3,(H,15,17)/t9-,10+/m0/s1 |
| InChIKey | IKOUHNPTDRFUOE-VHSXEESVSA-N |
| XLogP | 1.03 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |