C19H27N5O3S — CID 9304183
(2S)-2-[(4-benzyl-5-morpholin-4-yl-1,2,4-triazol-3-yl)sulfanyl]-N-(2-methoxyethyl)propanamide (PubChem CID 9304183) has the molecular formula C19H27N5O3S and a molecular weight of 405.52 g/mol. Its IUPAC name is (2S)-2-[(4-benzyl-5-morpholin-4-yl-1,2,4-triazol-3-yl)sulfanyl]-N-(2-methoxyethyl)propanamide.
| Compound Name | (2S)-2-[(4-benzyl-5-morpholin-4-yl-1,2,4-triazol-3-yl)sulfanyl]-N-(2-methoxyethyl)propanamide |
|---|---|
| PubChem CID | 9304183 |
| Molecular Formula | C19H27N5O3S |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 405.18 |
| IUPAC Name | (2S)-2-[(4-benzyl-5-morpholin-4-yl-1,2,4-triazol-3-yl)sulfanyl]-N-(2-methoxyethyl)propanamide |
| SMILES | COCCNC(=O)[C@H](C)Sc1nnc(N2CCOCC2)n1Cc1ccccc1 |
| InChI | InChI=1S/C19H27N5O3S/c1-15(17(25)20-8-11-26-2)28-19-22-21-18(23-9-12-27-13-10-23)24(19)14-16-6-4-3-5-7-16/h3-7,15H,8-14H2,1-2H3,(H,20,25)/t15-/m0/s1 |
| InChIKey | NHXGZNGDVLCCSV-HNNXBMFYSA-N |
| XLogP | 1.41 |
| TPSA | 81.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|