C10H19NO3 — CID 93044550
N-[(2S)-2-hydroxypropyl]-3-[(2R)-oxolan-2-yl]propanamide (PubChem CID 93044550) has the molecular formula C10H19NO3 and a molecular weight of 201.27 g/mol. Its IUPAC name is N-[(2S)-2-hydroxypropyl]-3-[(2R)-oxolan-2-yl]propanamide.
| Compound Name | N-[(2S)-2-hydroxypropyl]-3-[(2R)-oxolan-2-yl]propanamide |
|---|---|
| PubChem CID | 93044550 |
| Molecular Formula | C10H19NO3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.14 |
| IUPAC Name | N-[(2S)-2-hydroxypropyl]-3-[(2R)-oxolan-2-yl]propanamide |
| SMILES | C[C@H](O)CNC(=O)CC[C@H]1CCCO1 |
| InChI | InChI=1S/C10H19NO3/c1-8(12)7-11-10(13)5-4-9-3-2-6-14-9/h8-9,12H,2-7H2,1H3,(H,11,13)/t8-,9+/m0/s1 |
| InChIKey | FMOMUUUOMWKIFS-DTWKUNHWSA-N |
| XLogP | 0.44 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |