C14H19NO4 — CID 93044901
2-hydroxy-4-methoxy-N-[(1S)-1-[(2S)-oxolan-2-yl]ethyl]benzamide (PubChem CID 93044901) has the molecular formula C14H19NO4 and a molecular weight of 265.31 g/mol. Its IUPAC name is 2-hydroxy-4-methoxy-N-[(1S)-1-[(2S)-oxolan-2-yl]ethyl]benzamide.
| Compound Name | 2-hydroxy-4-methoxy-N-[(1S)-1-[(2S)-oxolan-2-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 93044901 |
| Molecular Formula | C14H19NO4 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | 2-hydroxy-4-methoxy-N-[(1S)-1-[(2S)-oxolan-2-yl]ethyl]benzamide |
| SMILES | COc1ccc(C(=O)N[C@@H](C)[C@@H]2CCCO2)c(O)c1 |
| InChI | InChI=1S/C14H19NO4/c1-9(13-4-3-7-19-13)15-14(17)11-6-5-10(18-2)8-12(11)16/h5-6,8-9,13,16H,3-4,7H2,1-2H3,(H,15,17)/t9-,13-/m0/s1 |
| InChIKey | YPHRXMKQWLOQMR-ZANVPECISA-N |
| XLogP | 1.70 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |