About N-[[(3R)-3,4-dihydro-2H-chromen-3-yl]methyl]-2-methyl-N-propan-2-ylpyrazole-3-carboxamide
N-[[(3R)-3,4-dihydro-2H-chromen-3-yl]methyl]-2-methyl-N-propan-2-ylpyrazole-3-carboxamide (PubChem CID 93045415) has the molecular formula C18H23N3O2
and a molecular weight of 313.40 g/mol. Its IUPAC name is N-[[(3R)-3,4-dihydro-2H-chromen-3-yl]methyl]-2-methyl-N-propan-2-ylpyrazole-3-carboxamide.
Molecular Properties
| Compound Name | N-[[(3R)-3,4-dihydro-2H-chromen-3-yl]methyl]-2-methyl-N-propan-2-ylpyrazole-3-carboxamide |
| PubChem CID | 93045415 |
| Molecular Formula | C18H23N3O2 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | N-[[(3R)-3,4-dihydro-2H-chromen-3-yl]methyl]-2-methyl-N-propan-2-ylpyrazole-3-carboxamide |
| SMILES | CC(C)N(C[C@@H]1COc2ccccc2C1)C(=O)c1ccnn1C |
| InChI | InChI=1S/C18H23N3O2/c1-13(2)21(18(22)16-8-9-19-20(16)3)11-14-10-15-6-4-5-7-17(15)23-12-14/h4-9,13-14H,10-12H2,1-3H3/t14-/m1/s1 |
| InChIKey | KKIVVOJVTFDJFN-CQSZACIVSA-N |
| XLogP | 2.52 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[[(3R)-3,4-dihydro-2H-chromen-3-yl]methyl]-2-methyl-N-propan-2-ylpyrazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[(3R)-3,4-dihydro-2H-chromen-3-yl]methyl]-2-methyl-N-propan-2-ylpyrazole-3-carboxamide?
The IUPAC name of N-[[(3R)-3,4-dihydro-2H-chromen-3-yl]methyl]-2-methyl-N-propan-2-ylpyrazole-3-carboxamide (CID 93045415) is N-[[(3R)-3,4-dihydro-2H-chromen-3-yl]methyl]-2-methyl-N-propan-2-ylpyrazole-3-carboxamide.
What is the SMILES notation for N-[[(3R)-3,4-dihydro-2H-chromen-3-yl]methyl]-2-methyl-N-propan-2-ylpyrazole-3-carboxamide?
The canonical SMILES for N-[[(3R)-3,4-dihydro-2H-chromen-3-yl]methyl]-2-methyl-N-propan-2-ylpyrazole-3-carboxamide is CC(C)N(C[C@@H]1COc2ccccc2C1)C(=O)c1ccnn1C.
What is the InChIKey of N-[[(3R)-3,4-dihydro-2H-chromen-3-yl]methyl]-2-methyl-N-propan-2-ylpyrazole-3-carboxamide?
The InChIKey is KKIVVOJVTFDJFN-CQSZACIVSA-N. The full InChI is InChI=1S/C18H23N3O2/c1-13(2)21(18(22)16-8-9-19-20(16)3)11-14-10-15-6-4-5-7-17(15)23-12-14/h4-9,13-14H,10-12H2,1-3H3/t14-/m1/s1.
What are the key properties of N-[[(3R)-3,4-dihydro-2H-chromen-3-yl]methyl]-2-methyl-N-propan-2-ylpyrazole-3-carboxamide?
N-[[(3R)-3,4-dihydro-2H-chromen-3-yl]methyl]-2-methyl-N-propan-2-ylpyrazole-3-carboxamide has a molecular weight of 313.40 g/mol, XLogP of 2.52, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[(3R)-3,4-dihydro-2H-chromen-3-yl]methyl]-2-methyl-N-propan-2-ylpyrazole-3-carboxamide is sourced from PubChem (CID 93045415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).