C10H20N2O2 — CID 93046631
tert-butyl (2R)-1-(aminomethyl)pyrrolidine-2-carboxylate (PubChem CID 93046631) has the molecular formula C10H20N2O2 and a molecular weight of 200.28 g/mol. Its IUPAC name is tert-butyl (2R)-1-(aminomethyl)pyrrolidine-2-carboxylate.
| Compound Name | tert-butyl (2R)-1-(aminomethyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 93046631 |
| Molecular Formula | C10H20N2O2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.15 |
| IUPAC Name | tert-butyl (2R)-1-(aminomethyl)pyrrolidine-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)[C@H]1CCCN1CN |
| InChI | InChI=1S/C10H20N2O2/c1-10(2,3)14-9(13)8-5-4-6-12(8)7-11/h8H,4-7,11H2,1-3H3/t8-/m1/s1 |
| InChIKey | UXSBBOCTQAJHSM-MRVPVSSYSA-N |
| XLogP | 0.71 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |