(2S)-2-amino-3-(4-hydroxy-3,5-diiodophenyl)propanoic acid

C9H9I2NO3 — CID 9305

💊View drug profile → diiodotyrosine
IUPAC(2S)-2-amino-3-(4-hydroxy-3,5-diiodophenyl)propanoic acid
SMILESN[C@@H](Cc1cc(I)c(O)c(I)c1)C(=O)O
InChIInChI=1S/C9H9I2NO3/c10-5-1-4(2-6(11)8(5)13)3-7(12)9(14)15/h1-2,7,13H,3,12H2,(H,14,15)/t7-/m0/s1
InChIKeyNYPYHUZRZVSYKL-ZETCQYMHSA-N
MW432.98 g/mol
LogP1.56
Rot. Bonds3

About (2S)-2-amino-3-(4-hydroxy-3,5-diiodophenyl)propanoic acid

(2S)-2-amino-3-(4-hydroxy-3,5-diiodophenyl)propanoic acid (PubChem CID 9305) has the molecular formula C9H9I2NO3 and a molecular weight of 432.98 g/mol. Its IUPAC name is (2S)-2-amino-3-(4-hydroxy-3,5-diiodophenyl)propanoic acid.

Molecular Properties

Compound Name(2S)-2-amino-3-(4-hydroxy-3,5-diiodophenyl)propanoic acid
PubChem CID9305
Molecular FormulaC9H9I2NO3
Molecular Weight432.98 g/mol
Exact Mass432.87
IUPAC Name(2S)-2-amino-3-(4-hydroxy-3,5-diiodophenyl)propanoic acid
SMILESN[C@@H](Cc1cc(I)c(O)c(I)c1)C(=O)O
InChIInChI=1S/C9H9I2NO3/c10-5-1-4(2-6(11)8(5)13)3-7(12)9(14)15/h1-2,7,13H,3,12H2,(H,14,15)/t7-/m0/s1
InChIKeyNYPYHUZRZVSYKL-ZETCQYMHSA-N
XLogP1.56
TPSA83.55 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500432.98
LogP ≤ 51.56
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'iodine', 'substructure': 'N/A'}

Analyze (2S)-2-amino-3-(4-hydroxy-3,5-diiodophenyl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2S)-2-amino-3-(4-hydroxy-3,5-diiodophenyl)propanoic acid?
The IUPAC name of (2S)-2-amino-3-(4-hydroxy-3,5-diiodophenyl)propanoic acid (CID 9305) is (2S)-2-amino-3-(4-hydroxy-3,5-diiodophenyl)propanoic acid.
What is the SMILES notation for (2S)-2-amino-3-(4-hydroxy-3,5-diiodophenyl)propanoic acid?
The canonical SMILES for (2S)-2-amino-3-(4-hydroxy-3,5-diiodophenyl)propanoic acid is N[C@@H](Cc1cc(I)c(O)c(I)c1)C(=O)O.
What is the InChIKey of (2S)-2-amino-3-(4-hydroxy-3,5-diiodophenyl)propanoic acid?
The InChIKey is NYPYHUZRZVSYKL-ZETCQYMHSA-N. The full InChI is InChI=1S/C9H9I2NO3/c10-5-1-4(2-6(11)8(5)13)3-7(12)9(14)15/h1-2,7,13H,3,12H2,(H,14,15)/t7-/m0/s1.
What are the key properties of (2S)-2-amino-3-(4-hydroxy-3,5-diiodophenyl)propanoic acid?
(2S)-2-amino-3-(4-hydroxy-3,5-diiodophenyl)propanoic acid has a molecular weight of 432.98 g/mol, XLogP of 1.56, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-amino-3-(4-hydroxy-3,5-diiodophenyl)propanoic acid is sourced from PubChem (CID 9305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).