C19H19FN4O3 — CID 9305124
N-[[4-(dimethylamino)phenyl]methyl]-2-[5-(4-fluorophenyl)-2-oxo-1,3,4-oxadiazol-3-yl]acetamide (PubChem CID 9305124) has the molecular formula C19H19FN4O3 and a molecular weight of 370.38 g/mol. Its IUPAC name is N-[[4-(dimethylamino)phenyl]methyl]-2-[5-(4-fluorophenyl)-2-oxo-1,3,4-oxadiazol-3-yl]acetamide.
| Compound Name | N-[[4-(dimethylamino)phenyl]methyl]-2-[5-(4-fluorophenyl)-2-oxo-1,3,4-oxadiazol-3-yl]acetamide |
|---|---|
| PubChem CID | 9305124 |
| Molecular Formula | C19H19FN4O3 |
| Molecular Weight | 370.38 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | N-[[4-(dimethylamino)phenyl]methyl]-2-[5-(4-fluorophenyl)-2-oxo-1,3,4-oxadiazol-3-yl]acetamide |
| SMILES | CN(C)c1ccc(CNC(=O)Cn2nc(-c3ccc(F)cc3)oc2=O)cc1 |
| InChI | InChI=1S/C19H19FN4O3/c1-23(2)16-9-3-13(4-10-16)11-21-17(25)12-24-19(26)27-18(22-24)14-5-7-15(20)8-6-14/h3-10H,11-12H2,1-2H3,(H,21,25) |
| InChIKey | SAYPAZPMONOKFN-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 80.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.38 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|