C13H19NO4 — CID 93054886
(2R)-2-[(5-ethylfuran-2-carbonyl)amino]-3,3-dimethylbutanoic acid (PubChem CID 93054886) has the molecular formula C13H19NO4 and a molecular weight of 253.30 g/mol. Its IUPAC name is (2R)-2-[(5-ethylfuran-2-carbonyl)amino]-3,3-dimethylbutanoic acid.
| Compound Name | (2R)-2-[(5-ethylfuran-2-carbonyl)amino]-3,3-dimethylbutanoic acid |
|---|---|
| PubChem CID | 93054886 |
| Molecular Formula | C13H19NO4 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | (2R)-2-[(5-ethylfuran-2-carbonyl)amino]-3,3-dimethylbutanoic acid |
| SMILES | CCc1ccc(C(=O)N[C@@H](C(=O)O)C(C)(C)C)o1 |
| InChI | InChI=1S/C13H19NO4/c1-5-8-6-7-9(18-8)11(15)14-10(12(16)17)13(2,3)4/h6-7,10H,5H2,1-4H3,(H,14,15)(H,16,17)/t10-/m0/s1 |
| InChIKey | LOLNVSDVOYGNEY-JTQLQIEISA-N |
| XLogP | 2.07 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |