About 1-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-3-phenylthiourea
1-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-3-phenylthiourea (PubChem CID 930568) has the molecular formula C16H12FN3S2
and a molecular weight of 329.43 g/mol. Its IUPAC name is 1-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-3-phenylthiourea.
Molecular Properties
| Compound Name | 1-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-3-phenylthiourea |
| PubChem CID | 930568 |
| Molecular Formula | C16H12FN3S2 |
| Molecular Weight | 329.43 g/mol |
| Exact Mass | 329.05 |
| IUPAC Name | 1-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-3-phenylthiourea |
| SMILES | Fc1ccc(-c2csc(NC(=S)Nc3ccccc3)n2)cc1 |
| InChI | InChI=1S/C16H12FN3S2/c17-12-8-6-11(7-9-12)14-10-22-16(19-14)20-15(21)18-13-4-2-1-3-5-13/h1-10H,(H2,18,19,20,21) |
| InChIKey | PLIZLGBKUVWUEA-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.43 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-3-phenylthiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-3-phenylthiourea?
The IUPAC name of 1-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-3-phenylthiourea (CID 930568) is 1-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-3-phenylthiourea.
What is the SMILES notation for 1-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-3-phenylthiourea?
The canonical SMILES for 1-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-3-phenylthiourea is Fc1ccc(-c2csc(NC(=S)Nc3ccccc3)n2)cc1.
What is the InChIKey of 1-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-3-phenylthiourea?
The InChIKey is PLIZLGBKUVWUEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12FN3S2/c17-12-8-6-11(7-9-12)14-10-22-16(19-14)20-15(21)18-13-4-2-1-3-5-13/h1-10H,(H2,18,19,20,21).
What are the key properties of 1-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-3-phenylthiourea?
1-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-3-phenylthiourea has a molecular weight of 329.43 g/mol, XLogP of 4.76, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-3-phenylthiourea is sourced from PubChem (CID 930568), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).