C24H28F3N3O2 — CID 93057923
N-(3-oxo-3-piperazin-1-ylpropyl)-N-[(2R)-2-phenylpropyl]-4-(trifluoromethyl)benzamide (PubChem CID 93057923) has the molecular formula C24H28F3N3O2 and a molecular weight of 447.50 g/mol. Its IUPAC name is N-(3-oxo-3-piperazin-1-ylpropyl)-N-[(2R)-2-phenylpropyl]-4-(trifluoromethyl)benzamide.
| Compound Name | N-(3-oxo-3-piperazin-1-ylpropyl)-N-[(2R)-2-phenylpropyl]-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 93057923 |
| Molecular Formula | C24H28F3N3O2 |
| Molecular Weight | 447.50 g/mol |
| Exact Mass | 447.21 |
| IUPAC Name | N-(3-oxo-3-piperazin-1-ylpropyl)-N-[(2R)-2-phenylpropyl]-4-(trifluoromethyl)benzamide |
| SMILES | C[C@@H](CN(CCC(=O)N1CCNCC1)C(=O)c1ccc(C(F)(F)F)cc1)c1ccccc1 |
| InChI | InChI=1S/C24H28F3N3O2/c1-18(19-5-3-2-4-6-19)17-30(14-11-22(31)29-15-12-28-13-16-29)23(32)20-7-9-21(10-8-20)24(25,26)27/h2-10,18,28H,11-17H2,1H3/t18-/m0/s1 |
| InChIKey | UIEZLQAXPBVRGI-SFHVURJKSA-N |
| XLogP | 3.77 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.50 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |