C25H30N4O4 — CID 93059893
(6aR)-5-[2-(2-ethoxyanilino)-2-oxoethyl]-N,N-dimethyl-6-oxo-7,8,9,10-tetrahydro-6aH-pyrido[1,2-a]quinoxaline-3-carboxamide (PubChem CID 93059893) has the molecular formula C25H30N4O4 and a molecular weight of 450.54 g/mol. Its IUPAC name is (6aR)-5-[2-(2-ethoxyanilino)-2-oxoethyl]-N,N-dimethyl-6-oxo-7,8,9,10-tetrahydro-6aH-pyrido[1,2-a]quinoxaline-3-carboxamide.
| Compound Name | (6aR)-5-[2-(2-ethoxyanilino)-2-oxoethyl]-N,N-dimethyl-6-oxo-7,8,9,10-tetrahydro-6aH-pyrido[1,2-a]quinoxaline-3-carboxamide |
|---|---|
| PubChem CID | 93059893 |
| Molecular Formula | C25H30N4O4 |
| Molecular Weight | 450.54 g/mol |
| Exact Mass | 450.23 |
| IUPAC Name | (6aR)-5-[2-(2-ethoxyanilino)-2-oxoethyl]-N,N-dimethyl-6-oxo-7,8,9,10-tetrahydro-6aH-pyrido[1,2-a]quinoxaline-3-carboxamide |
| SMILES | CCOc1ccccc1NC(=O)CN1C(=O)[C@H]2CCCCN2c2ccc(C(=O)N(C)C)cc21 |
| InChI | InChI=1S/C25H30N4O4/c1-4-33-22-11-6-5-9-18(22)26-23(30)16-29-21-15-17(24(31)27(2)3)12-13-19(21)28-14-8-7-10-20(28)25(29)32/h5-6,9,11-13,15,20H,4,7-8,10,14,16H2,1-3H3,(H,26,30)/t20-/m1/s1 |
| InChIKey | OCZJLGHNMOXBTQ-HXUWFJFHSA-N |
| XLogP | 3.13 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.54 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |