C24H38O5 — CID 93061254
[(6E,8S,10E,12S,14S)-12-acetyloxy-14-hydroxy-2,6,10,14-tetramethylhexadeca-2,6,10,15-tetraen-8-yl] acetate (PubChem CID 93061254) has the molecular formula C24H38O5 and a molecular weight of 406.56 g/mol. Its IUPAC name is [(6E,8S,10E,12S,14S)-12-acetyloxy-14-hydroxy-2,6,10,14-tetramethylhexadeca-2,6,10,15-tetraen-8-yl] acetate.
| Compound Name | [(6E,8S,10E,12S,14S)-12-acetyloxy-14-hydroxy-2,6,10,14-tetramethylhexadeca-2,6,10,15-tetraen-8-yl] acetate |
|---|---|
| PubChem CID | 93061254 |
| Molecular Formula | C24H38O5 |
| Molecular Weight | 406.56 g/mol |
| Exact Mass | 406.27 |
| IUPAC Name | [(6E,8S,10E,12S,14S)-12-acetyloxy-14-hydroxy-2,6,10,14-tetramethylhexadeca-2,6,10,15-tetraen-8-yl] acetate |
| SMILES | C=C[C@@](C)(O)C[C@@H](/C=C(\C)C[C@@H](/C=C(\C)CCC=C(C)C)OC(C)=O)OC(C)=O |
| InChI | InChI=1S/C24H38O5/c1-9-24(8,27)16-23(29-21(7)26)15-19(5)14-22(28-20(6)25)13-18(4)12-10-11-17(2)3/h9,11,13,15,22-23,27H,1,10,12,14,16H2,2-8H3/b18-13+,19-15+/t22-,23-,24-/m1/s1 |
| InChIKey | FRODFPSMCRXVNY-GKPGKSNJSA-N |
| XLogP | 5.21 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.56 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|