C12H17NO4S — CID 93072784
N-[(3S)-8-methoxy-3,4-dihydro-2H-chromen-3-yl]ethanesulfonamide (PubChem CID 93072784) has the molecular formula C12H17NO4S and a molecular weight of 271.34 g/mol. Its IUPAC name is N-[(3S)-8-methoxy-3,4-dihydro-2H-chromen-3-yl]ethanesulfonamide.
| Compound Name | N-[(3S)-8-methoxy-3,4-dihydro-2H-chromen-3-yl]ethanesulfonamide |
|---|---|
| PubChem CID | 93072784 |
| Molecular Formula | C12H17NO4S |
| Molecular Weight | 271.34 g/mol |
| Exact Mass | 271.09 |
| IUPAC Name | N-[(3S)-8-methoxy-3,4-dihydro-2H-chromen-3-yl]ethanesulfonamide |
| SMILES | CCS(=O)(=O)N[C@@H]1COc2c(cccc2OC)C1 |
| InChI | InChI=1S/C12H17NO4S/c1-3-18(14,15)13-10-7-9-5-4-6-11(16-2)12(9)17-8-10/h4-6,10,13H,3,7-8H2,1-2H3/t10-/m0/s1 |
| InChIKey | FLXZEXZCXVRUQG-JTQLQIEISA-N |
| XLogP | 0.94 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.34 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |