C28H39N3O3S — CID 93076182
N-[3-[cyclohexyl(methyl)amino]propyl]-2-[(1S)-2-(4-methylphenyl)sulfonyl-3,4-dihydro-1H-isoquinolin-1-yl]acetamide (PubChem CID 93076182) has the molecular formula C28H39N3O3S and a molecular weight of 497.71 g/mol. Its IUPAC name is N-[3-[cyclohexyl(methyl)amino]propyl]-2-[(1S)-2-(4-methylphenyl)sulfonyl-3,4-dihydro-1H-isoquinolin-1-yl]acetamide.
| Compound Name | N-[3-[cyclohexyl(methyl)amino]propyl]-2-[(1S)-2-(4-methylphenyl)sulfonyl-3,4-dihydro-1H-isoquinolin-1-yl]acetamide |
|---|---|
| PubChem CID | 93076182 |
| Molecular Formula | C28H39N3O3S |
| Molecular Weight | 497.71 g/mol |
| Exact Mass | 497.27 |
| IUPAC Name | N-[3-[cyclohexyl(methyl)amino]propyl]-2-[(1S)-2-(4-methylphenyl)sulfonyl-3,4-dihydro-1H-isoquinolin-1-yl]acetamide |
| SMILES | Cc1ccc(S(=O)(=O)N2CCc3ccccc3[C@@H]2CC(=O)NCCCN(C)C2CCCCC2)cc1 |
| InChI | InChI=1S/C28H39N3O3S/c1-22-13-15-25(16-14-22)35(33,34)31-20-17-23-9-6-7-12-26(23)27(31)21-28(32)29-18-8-19-30(2)24-10-4-3-5-11-24/h6-7,9,12-16,24,27H,3-5,8,10-11,17-21H2,1-2H3,(H,29,32)/t27-/m0/s1 |
| InChIKey | VWMLBPUFMHYKHC-MHZLTWQESA-N |
| XLogP | 4.44 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.71 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|